C31H37N9O4 — CID 159875291
1,3-diethylindazol-5-amine;1,3-diethyl-5-nitroindazole;3-ethyl-5-nitro-2H-indazole (PubChem CID 159875291) has the molecular formula C31H37N9O4 and a molecular weight of 599.70 g/mol. Its IUPAC name is 1,3-diethylindazol-5-amine;1,3-diethyl-5-nitroindazole;3-ethyl-5-nitro-2H-indazole.
| Compound Name | 1,3-diethylindazol-5-amine;1,3-diethyl-5-nitroindazole;3-ethyl-5-nitro-2H-indazole |
|---|---|
| PubChem CID | 159875291 |
| Molecular Formula | C31H37N9O4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 1,3-diethylindazol-5-amine;1,3-diethyl-5-nitroindazole;3-ethyl-5-nitro-2H-indazole |
| SMILES | CCc1[nH]nc2ccc([N+](=O)[O-])cc12.CCc1nn(CC)c2ccc(N)cc12.CCc1nn(CC)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C11H13N3O2.C11H15N3.C9H9N3O2/c1-3-10-9-7-8(14(15)16)5-6-11(9)13(4-2)12-10;1-3-10-9-7-8(12)5-6-11(9)14(4-2)13-10;1-2-8-7-5-6(12(13)14)3-4-9(7)11-10-8/h5-7H,3-4H2,1-2H3;5-7H,3-4,12H2,1-2H3;3-5H,2H2,1H3,(H,10,11) |
| InChIKey | NSVBRAUTPLWYRD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|