C34H39F4N9O4 — CID 161055162
1-(2,2-difluoroethyl)-5-nitro-3-propylindazole;1-(2,2-difluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole (PubChem CID 161055162) has the molecular formula C34H39F4N9O4 and a molecular weight of 713.74 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-nitro-3-propylindazole;1-(2,2-difluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole.
| Compound Name | 1-(2,2-difluoroethyl)-5-nitro-3-propylindazole;1-(2,2-difluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole |
|---|---|
| PubChem CID | 161055162 |
| Molecular Formula | C34H39F4N9O4 |
| Molecular Weight | 713.74 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-nitro-3-propylindazole;1-(2,2-difluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole |
| SMILES | CCCc1[nH]nc2ccc([N+](=O)[O-])cc12.CCCc1nn(CC(F)F)c2ccc(N)cc12.CCCc1nn(CC(F)F)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C12H13F2N3O2.C12H15F2N3.C10H11N3O2/c1-2-3-10-9-6-8(17(18)19)4-5-11(9)16(15-10)7-12(13)14;1-2-3-10-9-6-8(15)4-5-11(9)17(16-10)7-12(13)14;1-2-3-9-8-6-7(13(14)15)4-5-10(8)12-11-9/h4-6,12H,2-3,7H2,1H3;4-6,12H,2-3,7,15H2,1H3;4-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | UCQODMZGCZZXIB-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.74 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|