C13H12F2N6O2 — CID 126814575
1-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methyl]-3-methyl-5-nitroindazole (PubChem CID 126814575) has the molecular formula C13H12F2N6O2 and a molecular weight of 322.28 g/mol. Its IUPAC name is 1-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methyl]-3-methyl-5-nitroindazole.
| Compound Name | 1-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methyl]-3-methyl-5-nitroindazole |
|---|---|
| PubChem CID | 126814575 |
| Molecular Formula | C13H12F2N6O2 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methyl]-3-methyl-5-nitroindazole |
| SMILES | Cc1nn(Cc2ncnn2CC(F)F)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C13H12F2N6O2/c1-8-10-4-9(21(22)23)2-3-11(10)19(18-8)6-13-16-7-17-20(13)5-12(14)15/h2-4,7,12H,5-6H2,1H3 |
| InChIKey | AIOALYGDIQJPQJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|