C30H35N9O6 — CID 158522525
1-(2-methoxyethyl)-3-methylindazol-5-amine;1-(2-methoxyethyl)-3-methyl-5-nitroindazole;3-methyl-5-nitro-2H-indazole (PubChem CID 158522525) has the molecular formula C30H35N9O6 and a molecular weight of 617.67 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-methylindazol-5-amine;1-(2-methoxyethyl)-3-methyl-5-nitroindazole;3-methyl-5-nitro-2H-indazole.
| Compound Name | 1-(2-methoxyethyl)-3-methylindazol-5-amine;1-(2-methoxyethyl)-3-methyl-5-nitroindazole;3-methyl-5-nitro-2H-indazole |
|---|---|
| PubChem CID | 158522525 |
| Molecular Formula | C30H35N9O6 |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 1-(2-methoxyethyl)-3-methylindazol-5-amine;1-(2-methoxyethyl)-3-methyl-5-nitroindazole;3-methyl-5-nitro-2H-indazole |
| SMILES | COCCn1nc(C)c2cc(N)ccc21.COCCn1nc(C)c2cc([N+](=O)[O-])ccc21.Cc1[nH]nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C11H13N3O3.C11H15N3O.C8H7N3O2/c1-8-10-7-9(14(15)16)3-4-11(10)13(12-8)5-6-17-2;1-8-10-7-9(12)3-4-11(10)14(13-8)5-6-15-2;1-5-7-4-6(11(12)13)2-3-8(7)10-9-5/h3-4,7H,5-6H2,1-2H3;3-4,7H,5-6,12H2,1-2H3;2-4H,1H3,(H,9,10) |
| InChIKey | HMJSLBFZGDRRAP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|