About 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline
2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline (PubChem CID 157429594) has the molecular formula C18H20F2N2O2
and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline.
Molecular Properties
| Compound Name | 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline |
| PubChem CID | 157429594 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline |
| SMILES | C=CCc1ccc([N+](=O)[O-])cc1F.CCCc1ccc(N)cc1F |
| InChI | InChI=1S/C9H8FNO2.C9H12FN/c1-2-3-7-4-5-8(11(12)13)6-9(7)10;1-2-3-7-4-5-8(11)6-9(7)10/h2,4-6H,1,3H2;4-6H,2-3,11H2,1H3 |
| InChIKey | BQJIZLXRJWHRBE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline?
The IUPAC name of 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline (CID 157429594) is 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline.
What is the SMILES notation for 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline?
The canonical SMILES for 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline is C=CCc1ccc([N+](=O)[O-])cc1F.CCCc1ccc(N)cc1F.
What is the InChIKey of 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline?
The InChIKey is BQJIZLXRJWHRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2.C9H12FN/c1-2-3-7-4-5-8(11(12)13)6-9(7)10;1-2-3-7-4-5-8(11)6-9(7)10/h2,4-6H,1,3H2;4-6H,2-3,11H2,1H3.
What are the key properties of 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline?
2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline has a molecular weight of 334.37 g/mol, XLogP of 4.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-nitro-1-prop-2-enylbenzene;3-fluoro-4-propylaniline is sourced from PubChem (CID 157429594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).