C26H24N4O6 — CID 171887794
9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-(6-nitro-2H-indazol-3-yl)butyl]carbamate (PubChem CID 171887794) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-(6-nitro-2H-indazol-3-yl)butyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-(6-nitro-2H-indazol-3-yl)butyl]carbamate |
|---|---|
| PubChem CID | 171887794 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-(6-nitro-2H-indazol-3-yl)butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1[nH]nc2cc([N+](=O)[O-])ccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H24N4O6/c31-23(25(32)24-20-10-9-15(30(34)35)13-22(20)28-29-24)11-12-27-26(33)36-14-21-18-7-3-1-5-16(18)17-6-2-4-8-19(17)21/h1-10,13,21,23,25,31-32H,11-12,14H2,(H,27,33)(H,28,29) |
| InChIKey | QHNUMVBRWRJVCK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 150.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|