C26H20N4O4 — CID 170461887
9H-fluoren-9-ylmethyl N-[4-(6-nitro-2H-indazol-3-yl)but-3-ynyl]carbamate (PubChem CID 170461887) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(6-nitro-2H-indazol-3-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(6-nitro-2H-indazol-3-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461887 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(6-nitro-2H-indazol-3-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1[nH]nc2cc([N+](=O)[O-])ccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H20N4O4/c31-26(34-16-23-20-9-3-1-7-18(20)19-8-2-4-10-21(19)23)27-14-6-5-11-24-22-13-12-17(30(32)33)15-25(22)29-28-24/h1-4,7-10,12-13,15,23H,6,14,16H2,(H,27,31)(H,28,29) |
| InChIKey | XDSMWVBWJKLUGC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|