C25H18Cl2N2O4 — CID 170461414
9H-fluoren-9-ylmethyl N-[4-(4,5-dichloro-2-nitrophenyl)but-3-ynyl]carbamate (PubChem CID 170461414) has the molecular formula C25H18Cl2N2O4 and a molecular weight of 481.34 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4,5-dichloro-2-nitrophenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4,5-dichloro-2-nitrophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461414 |
| Molecular Formula | C25H18Cl2N2O4 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4,5-dichloro-2-nitrophenyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H18Cl2N2O4/c26-22-13-16(24(29(31)32)14-23(22)27)7-5-6-12-28-25(30)33-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-11,13-14,21H,6,12,15H2,(H,28,30) |
| InChIKey | SYNJXUOEIPICOD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|