C25H19ClN2O4 — CID 170461163
9H-fluoren-9-ylmethyl N-[4-(2-chloro-5-nitrophenyl)but-3-ynyl]carbamate (PubChem CID 170461163) has the molecular formula C25H19ClN2O4 and a molecular weight of 446.89 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-chloro-5-nitrophenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-5-nitrophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461163 |
| Molecular Formula | C25H19ClN2O4 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-5-nitrophenyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cc([N+](=O)[O-])ccc1Cl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H19ClN2O4/c26-24-13-12-18(28(30)31)15-17(24)7-5-6-14-27-25(29)32-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-13,15,23H,6,14,16H2,(H,27,29) |
| InChIKey | RLRJFPDVWPHURP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|