C8H6Cl3NO2 — CID 56979701
3-(2,2,2-trichloroethyl)pyridine-4-carboxylic acid (PubChem CID 56979701) has the molecular formula C8H6Cl3NO2 and a molecular weight of 254.50 g/mol. Its IUPAC name is 3-(2,2,2-trichloroethyl)pyridine-4-carboxylic acid.
| Compound Name | 3-(2,2,2-trichloroethyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 56979701 |
| Molecular Formula | C8H6Cl3NO2 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 3-(2,2,2-trichloroethyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6Cl3NO2/c9-8(10,11)3-5-4-12-2-1-6(5)7(13)14/h1-2,4H,3H2,(H,13,14) |
| InChIKey | COPCHBNJEBFFKA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|