C9H13F2N3O — CID 103787955
1,1-difluoro-3-(1-pyrazin-2-ylethylamino)propan-2-ol (PubChem CID 103787955) has the molecular formula C9H13F2N3O and a molecular weight of 217.22 g/mol. Its IUPAC name is 1,1-difluoro-3-(1-pyrazin-2-ylethylamino)propan-2-ol.
| Compound Name | 1,1-difluoro-3-(1-pyrazin-2-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 103787955 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1,1-difluoro-3-(1-pyrazin-2-ylethylamino)propan-2-ol |
| SMILES | CC(NCC(O)C(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H13F2N3O/c1-6(7-4-12-2-3-13-7)14-5-8(15)9(10)11/h2-4,6,8-9,14-15H,5H2,1H3 |
| InChIKey | VCTVWBLRKVIPEW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |