C9H13F2N3 — CID 103759753
N-(2,2-difluoro-1-pyrazin-2-ylethyl)propan-1-amine (PubChem CID 103759753) has the molecular formula C9H13F2N3 and a molecular weight of 201.22 g/mol. Its IUPAC name is N-(2,2-difluoro-1-pyrazin-2-ylethyl)propan-1-amine.
| Compound Name | N-(2,2-difluoro-1-pyrazin-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 103759753 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | N-(2,2-difluoro-1-pyrazin-2-ylethyl)propan-1-amine |
| SMILES | CCCNC(c1cnccn1)C(F)F |
| InChI | InChI=1S/C9H13F2N3/c1-2-3-14-8(9(10)11)7-6-12-4-5-13-7/h4-6,8-9,14H,2-3H2,1H3 |
| InChIKey | NHJOYVSGFGKYOL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |