C15H27N3O — CID 116726100
2-ethoxy-3,3-dimethyl-N-propyl-1-pyrazin-2-ylbutan-1-amine (PubChem CID 116726100) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-N-propyl-1-pyrazin-2-ylbutan-1-amine.
| Compound Name | 2-ethoxy-3,3-dimethyl-N-propyl-1-pyrazin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 116726100 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-N-propyl-1-pyrazin-2-ylbutan-1-amine |
| SMILES | CCCNC(c1cnccn1)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C15H27N3O/c1-6-8-18-13(12-11-16-9-10-17-12)14(19-7-2)15(3,4)5/h9-11,13-14,18H,6-8H2,1-5H3 |
| InChIKey | IDHRYEINHAIKDC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |