C11H16F3N3 — CID 64567832
4,4,4-trifluoro-N-propyl-1-pyrazin-2-ylbutan-1-amine (PubChem CID 64567832) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-propyl-1-pyrazin-2-ylbutan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-propyl-1-pyrazin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 64567832 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4,4,4-trifluoro-N-propyl-1-pyrazin-2-ylbutan-1-amine |
| SMILES | CCCNC(CCC(F)(F)F)c1cnccn1 |
| InChI | InChI=1S/C11H16F3N3/c1-2-5-16-9(3-4-11(12,13)14)10-8-15-6-7-17-10/h6-9,16H,2-5H2,1H3 |
| InChIKey | ZLIRKQRDMPJRNY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |