C12H18F3N3 — CID 113327036
5,5,5-trifluoro-N-propyl-1-pyrimidin-4-ylpentan-1-amine (PubChem CID 113327036) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-propyl-1-pyrimidin-4-ylpentan-1-amine.
| Compound Name | 5,5,5-trifluoro-N-propyl-1-pyrimidin-4-ylpentan-1-amine |
|---|---|
| PubChem CID | 113327036 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5,5,5-trifluoro-N-propyl-1-pyrimidin-4-ylpentan-1-amine |
| SMILES | CCCNC(CCCC(F)(F)F)c1ccncn1 |
| InChI | InChI=1S/C12H18F3N3/c1-2-7-17-10(4-3-6-12(13,14)15)11-5-8-16-9-18-11/h5,8-10,17H,2-4,6-7H2,1H3 |
| InChIKey | CQSPOXKKNLJZEK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |