C13H16BrN3S — CID 63989185
N-[2-(5-bromothiophen-2-yl)-1-pyrimidin-4-ylethyl]propan-1-amine (PubChem CID 63989185) has the molecular formula C13H16BrN3S and a molecular weight of 326.26 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)-1-pyrimidin-4-ylethyl]propan-1-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)-1-pyrimidin-4-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 63989185 |
| Molecular Formula | C13H16BrN3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)-1-pyrimidin-4-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Br)s1)c1ccncn1 |
| InChI | InChI=1S/C13H16BrN3S/c1-2-6-16-12(11-5-7-15-9-17-11)8-10-3-4-13(14)18-10/h3-5,7,9,12,16H,2,6,8H2,1H3 |
| InChIKey | PNMXFOIWVKSIIC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |