C14H25N3 — CID 63988767
4,4-dimethyl-N-propyl-1-pyrimidin-4-ylpentan-1-amine (PubChem CID 63988767) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 4,4-dimethyl-N-propyl-1-pyrimidin-4-ylpentan-1-amine.
| Compound Name | 4,4-dimethyl-N-propyl-1-pyrimidin-4-ylpentan-1-amine |
|---|---|
| PubChem CID | 63988767 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 4,4-dimethyl-N-propyl-1-pyrimidin-4-ylpentan-1-amine |
| SMILES | CCCNC(CCC(C)(C)C)c1ccncn1 |
| InChI | InChI=1S/C14H25N3/c1-5-9-16-12(6-8-14(2,3)4)13-7-10-15-11-17-13/h7,10-12,16H,5-6,8-9H2,1-4H3 |
| InChIKey | ZEOBTRLPSRPHOX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |