C12H12BrFN2S — CID 105139329
2-(4-bromothiophen-2-yl)-1-(5-fluoro-3-pyridinyl)-N-methylethanamine (PubChem CID 105139329) has the molecular formula C12H12BrFN2S and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(5-fluoro-3-pyridinyl)-N-methylethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(5-fluoro-3-pyridinyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105139329 |
| Molecular Formula | C12H12BrFN2S |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(5-fluoro-3-pyridinyl)-N-methylethanamine |
| SMILES | CNC(Cc1cc(Br)cs1)c1cncc(F)c1 |
| InChI | InChI=1S/C12H12BrFN2S/c1-15-12(4-11-3-9(13)7-17-11)8-2-10(14)6-16-5-8/h2-3,5-7,12,15H,4H2,1H3 |
| InChIKey | NLXXGVUYFGJMMF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |