C12H16N4S — CID 105308717
(1-pyrazin-2-yl-4-thiophen-2-ylbutyl)hydrazine (PubChem CID 105308717) has the molecular formula C12H16N4S and a molecular weight of 248.36 g/mol. Its IUPAC name is (1-pyrazin-2-yl-4-thiophen-2-ylbutyl)hydrazine.
| Compound Name | (1-pyrazin-2-yl-4-thiophen-2-ylbutyl)hydrazine |
|---|---|
| PubChem CID | 105308717 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (1-pyrazin-2-yl-4-thiophen-2-ylbutyl)hydrazine |
| SMILES | NNC(CCCc1cccs1)c1cnccn1 |
| InChI | InChI=1S/C12H16N4S/c13-16-11(12-9-14-6-7-15-12)5-1-3-10-4-2-8-17-10/h2,4,6-9,11,16H,1,3,5,13H2 |
| InChIKey | SLSRPFLOLDAGQU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|