C14H19N3S — CID 105333745
(1-pyridin-3-yl-5-thiophen-2-ylpentan-2-yl)hydrazine (PubChem CID 105333745) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is (1-pyridin-3-yl-5-thiophen-2-ylpentan-2-yl)hydrazine.
| Compound Name | (1-pyridin-3-yl-5-thiophen-2-ylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105333745 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (1-pyridin-3-yl-5-thiophen-2-ylpentan-2-yl)hydrazine |
| SMILES | NNC(CCCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C14H19N3S/c15-17-13(10-12-4-2-8-16-11-12)5-1-6-14-7-3-9-18-14/h2-4,7-9,11,13,17H,1,5-6,10,15H2 |
| InChIKey | MIUNVJUKZYJWHQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|