C11H17N5S — CID 105337635
[1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutyl]hydrazine (PubChem CID 105337635) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is [1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutyl]hydrazine.
| Compound Name | [1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutyl]hydrazine |
|---|---|
| PubChem CID | 105337635 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutyl]hydrazine |
| SMILES | Cn1nncc1C(CCCc1cccs1)NN |
| InChI | InChI=1S/C11H17N5S/c1-16-11(8-13-15-16)10(14-12)6-2-4-9-5-3-7-17-9/h3,5,7-8,10,14H,2,4,6,12H2,1H3 |
| InChIKey | NHMZHNQONYCECA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|