C12H16N4S — CID 105262110
[1-(3-ethyl-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105262110) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is [1-(3-ethyl-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(3-ethyl-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105262110 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [1-(3-ethyl-4-pyridinyl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | CCc1cnccc1C(Cc1cncs1)NN |
| InChI | InChI=1S/C12H16N4S/c1-2-9-6-14-4-3-11(9)12(16-13)5-10-7-15-8-17-10/h3-4,6-8,12,16H,2,5,13H2,1H3 |
| InChIKey | SPJNCFQOMCULGI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|