C11H10Cl2N2O — CID 83182559
1-(3,5-dichloro-2-pyridinyl)-2-(furan-3-yl)ethanamine (PubChem CID 83182559) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-2-(furan-3-yl)ethanamine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-2-(furan-3-yl)ethanamine |
|---|---|
| PubChem CID | 83182559 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-2-(furan-3-yl)ethanamine |
| SMILES | NC(Cc1ccoc1)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O/c12-8-4-9(13)11(15-5-8)10(14)3-7-1-2-16-6-7/h1-2,4-6,10H,3,14H2 |
| InChIKey | ITSUEKHAPRJNMB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |