C13H10BrCl2FN2 — CID 79781021
2-(4-bromo-2-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanamine (PubChem CID 79781021) has the molecular formula C13H10BrCl2FN2 and a molecular weight of 364.05 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 79781021 |
| Molecular Formula | C13H10BrCl2FN2 |
| Molecular Weight | 364.05 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanamine |
| SMILES | NC(Cc1ccc(Br)cc1F)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10BrCl2FN2/c14-8-2-1-7(11(17)4-8)3-12(18)13-10(16)5-9(15)6-19-13/h1-2,4-6,12H,3,18H2 |
| InChIKey | NEMSRLBUDFNSNS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.05 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |