C12H22N4O3 — CID 105332275
[1-(3,5-dimethoxypyrazin-2-yl)-3-propoxypropyl]hydrazine (PubChem CID 105332275) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is [1-(3,5-dimethoxypyrazin-2-yl)-3-propoxypropyl]hydrazine.
| Compound Name | [1-(3,5-dimethoxypyrazin-2-yl)-3-propoxypropyl]hydrazine |
|---|---|
| PubChem CID | 105332275 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [1-(3,5-dimethoxypyrazin-2-yl)-3-propoxypropyl]hydrazine |
| SMILES | CCCOCCC(NN)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C12H22N4O3/c1-4-6-19-7-5-9(16-13)11-12(18-3)15-10(17-2)8-14-11/h8-9,16H,4-7,13H2,1-3H3 |
| InChIKey | CMJJWSBCYYVVOB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|