C11H16F3N3O3 — CID 103216134
1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103216134) has the molecular formula C11H16F3N3O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103216134 |
| Molecular Formula | C11H16F3N3O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | COc1cnc(C(N)CCOCC(F)(F)F)c(OC)n1 |
| InChI | InChI=1S/C11H16F3N3O3/c1-18-8-5-16-9(10(17-8)19-2)7(15)3-4-20-6-11(12,13)14/h5,7H,3-4,6,15H2,1-2H3 |
| InChIKey | UYTUWXGHFADWMV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|