C9H12F3N3O2 — CID 114983788
1-(3,5-dimethoxypyrazin-2-yl)-3,3,3-trifluoropropan-1-amine (PubChem CID 114983788) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 114983788 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-3,3,3-trifluoropropan-1-amine |
| SMILES | COc1cnc(C(N)CC(F)(F)F)c(OC)n1 |
| InChI | InChI=1S/C9H12F3N3O2/c1-16-6-4-14-7(8(15-6)17-2)5(13)3-9(10,11)12/h4-5H,3,13H2,1-2H3 |
| InChIKey | XKQWNWPHNRWXOQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |