C14H19N3O2S — CID 105178245
1-(3,5-dimethoxypyrazin-2-yl)-4-thiophen-2-ylbutan-1-amine (PubChem CID 105178245) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 105178245 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-4-thiophen-2-ylbutan-1-amine |
| SMILES | COc1cnc(C(N)CCCc2cccs2)c(OC)n1 |
| InChI | InChI=1S/C14H19N3O2S/c1-18-12-9-16-13(14(17-12)19-2)11(15)7-3-5-10-6-4-8-20-10/h4,6,8-9,11H,3,5,7,15H2,1-2H3 |
| InChIKey | BRCYDKGGQGOJSB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |