C17H23NO2S — CID 65185856
1-amino-2-(4-methoxyphenyl)-6-thiophen-2-ylhexan-3-ol (PubChem CID 65185856) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-amino-2-(4-methoxyphenyl)-6-thiophen-2-ylhexan-3-ol.
| Compound Name | 1-amino-2-(4-methoxyphenyl)-6-thiophen-2-ylhexan-3-ol |
|---|---|
| PubChem CID | 65185856 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-amino-2-(4-methoxyphenyl)-6-thiophen-2-ylhexan-3-ol |
| SMILES | COc1ccc(C(CN)C(O)CCCc2cccs2)cc1 |
| InChI | InChI=1S/C17H23NO2S/c1-20-14-9-7-13(8-10-14)16(12-18)17(19)6-2-4-15-5-3-11-21-15/h3,5,7-11,16-17,19H,2,4,6,12,18H2,1H3 |
| InChIKey | YJPFUSAGBXNLCK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |