C17H23NO2S — CID 105168382
1-(3,5-dimethoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine (PubChem CID 105168382) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(3,5-dimethoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 105168382 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine |
| SMILES | CNC(CCCc1cccs1)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C17H23NO2S/c1-18-17(8-4-6-16-7-5-9-21-16)13-10-14(19-2)12-15(11-13)20-3/h5,7,9-12,17-18H,4,6,8H2,1-3H3 |
| InChIKey | IKSKDESFNXQPFG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |