C16H20FNOS — CID 103397395
1-(2-fluoro-4-methoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine (PubChem CID 103397395) has the molecular formula C16H20FNOS and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 103397395 |
| Molecular Formula | C16H20FNOS |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-N-methyl-4-thiophen-2-ylbutan-1-amine |
| SMILES | CNC(CCCc1cccs1)c1ccc(OC)cc1F |
| InChI | InChI=1S/C16H20FNOS/c1-18-16(7-3-5-13-6-4-10-20-13)14-9-8-12(19-2)11-15(14)17/h4,6,8-11,16,18H,3,5,7H2,1-2H3 |
| InChIKey | XXLXBWNJPVCOOI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |