C13H14FNOS — CID 43561402
1-(2-fluoro-4-methoxyphenyl)-N-methyl-1-thiophen-2-ylmethanamine (PubChem CID 43561402) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-N-methyl-1-thiophen-2-ylmethanamine.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-N-methyl-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 43561402 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-N-methyl-1-thiophen-2-ylmethanamine |
| SMILES | CNC(c1cccs1)c1ccc(OC)cc1F |
| InChI | InChI=1S/C13H14FNOS/c1-15-13(12-4-3-7-17-12)10-6-5-9(16-2)8-11(10)14/h3-8,13,15H,1-2H3 |
| InChIKey | ZKDJINWLYPHJOL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |