C15H15FINO — CID 43561417
1-(2-fluoro-4-methoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine (PubChem CID 43561417) has the molecular formula C15H15FINO and a molecular weight of 371.19 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43561417 |
| Molecular Formula | C15H15FINO |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)cc1)c1ccc(OC)cc1F |
| InChI | InChI=1S/C15H15FINO/c1-18-15(10-3-5-11(17)6-4-10)13-8-7-12(19-2)9-14(13)16/h3-9,15,18H,1-2H3 |
| InChIKey | HZVQFQHSMYTZQS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|