C16H21NOS — CID 63774226
N-ethyl-1-(4-methoxyphenyl)-3-thiophen-2-ylpropan-1-amine (PubChem CID 63774226) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is N-ethyl-1-(4-methoxyphenyl)-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-ethyl-1-(4-methoxyphenyl)-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 63774226 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-ethyl-1-(4-methoxyphenyl)-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCNC(CCc1cccs1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21NOS/c1-3-17-16(11-10-15-5-4-12-19-15)13-6-8-14(18-2)9-7-13/h4-9,12,16-17H,3,10-11H2,1-2H3 |
| InChIKey | VNHVOWYQOQYHGM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |