C16H19F2NOS — CID 115860987
1-[4-(difluoromethoxy)phenyl]-N-ethyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 115860987) has the molecular formula C16H19F2NOS and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-N-ethyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-N-ethyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 115860987 |
| Molecular Formula | C16H19F2NOS |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-N-ethyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCNC(CCc1cccs1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H19F2NOS/c1-2-19-15(10-9-14-4-3-11-21-14)12-5-7-13(8-6-12)20-16(17)18/h3-8,11,15-16,19H,2,9-10H2,1H3 |
| InChIKey | LDNZZPMZGKVDDT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |