C12H19F2N3O3 — CID 103216140
3-(2,2-difluoroethoxy)-1-(3,5-dimethoxypyrazin-2-yl)-N-methylpropan-1-amine (PubChem CID 103216140) has the molecular formula C12H19F2N3O3 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3,5-dimethoxypyrazin-2-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3,5-dimethoxypyrazin-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103216140 |
| Molecular Formula | C12H19F2N3O3 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3,5-dimethoxypyrazin-2-yl)-N-methylpropan-1-amine |
| SMILES | CNC(CCOCC(F)F)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C12H19F2N3O3/c1-15-8(4-5-20-7-9(13)14)11-12(19-3)17-10(18-2)6-16-11/h6,8-9,15H,4-5,7H2,1-3H3 |
| InChIKey | SXGVNCTZOHBJPS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|