C9H10F6N2OS — CID 106783793
3-(2,2,2-trifluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine (PubChem CID 106783793) has the molecular formula C9H10F6N2OS and a molecular weight of 308.25 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine.
| Compound Name | 3-(2,2,2-trifluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 106783793 |
| Molecular Formula | C9H10F6N2OS |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-(2,2,2-trifluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine |
| SMILES | NC(CCOCC(F)(F)F)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H10F6N2OS/c10-8(11,12)4-18-2-1-5(16)6-3-17-7(19-6)9(13,14)15/h3,5H,1-2,4,16H2 |
| InChIKey | MZRYVHMTHDABKJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|