C9H10F3NOS — CID 106784127
4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-2-one (PubChem CID 106784127) has the molecular formula C9H10F3NOS and a molecular weight of 237.25 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-2-one.
| Compound Name | 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-2-one |
|---|---|
| PubChem CID | 106784127 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-2-one |
| SMILES | CC(=O)CC(C)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H10F3NOS/c1-5(3-6(2)14)7-4-13-8(15-7)9(10,11)12/h4-5H,3H2,1-2H3 |
| InChIKey | LQHXUALLRJJFCX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |