2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid

C9H10F3NO2S — CID 106784489

IUPAC2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid
SMILESCC(C(=O)O)C(C)c1cnc(C(F)(F)F)s1
InChIInChI=1S/C9H10F3NO2S/c1-4(5(2)7(14)15)6-3-13-8(16-6)9(10,11)12/h3-5H,1-2H3,(H,14,15)
InChIKeyKRMXGTDRXNZMKQ-UHFFFAOYSA-N
MW253.24 g/mol
LogP2.99
Rot. Bonds3

About 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid

2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid (PubChem CID 106784489) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid.

Molecular Properties

Compound Name2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid
PubChem CID106784489
Molecular FormulaC9H10F3NO2S
Molecular Weight253.24 g/mol
Exact Mass253.04
IUPAC Name2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid
SMILESCC(C(=O)O)C(C)c1cnc(C(F)(F)F)s1
InChIInChI=1S/C9H10F3NO2S/c1-4(5(2)7(14)15)6-3-13-8(16-6)9(10,11)12/h3-5H,1-2H3,(H,14,15)
InChIKeyKRMXGTDRXNZMKQ-UHFFFAOYSA-N
XLogP2.99
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.24
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid?
The IUPAC name of 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid (CID 106784489) is 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid.
What is the SMILES notation for 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid?
The canonical SMILES for 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid is CC(C(=O)O)C(C)c1cnc(C(F)(F)F)s1.
What is the InChIKey of 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid?
The InChIKey is KRMXGTDRXNZMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO2S/c1-4(5(2)7(14)15)6-3-13-8(16-6)9(10,11)12/h3-5H,1-2H3,(H,14,15).
What are the key properties of 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid?
2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid has a molecular weight of 253.24 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoic acid is sourced from PubChem (CID 106784489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).