C8H10F3NO2S — CID 106782928
1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butane-1,2-diol (PubChem CID 106782928) has the molecular formula C8H10F3NO2S and a molecular weight of 241.23 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butane-1,2-diol.
| Compound Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 106782928 |
| Molecular Formula | C8H10F3NO2S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butane-1,2-diol |
| SMILES | CCC(O)C(O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H10F3NO2S/c1-2-4(13)6(14)5-3-12-7(15-5)8(9,10)11/h3-4,6,13-14H,2H2,1H3 |
| InChIKey | BLPMUKGRMAIOEG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |