C10H13F5N2OS — CID 106783796
3-(2,2-difluoroethoxy)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine (PubChem CID 106783796) has the molecular formula C10H13F5N2OS and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 106783796 |
| Molecular Formula | C10H13F5N2OS |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-amine |
| SMILES | CNC(CCOCC(F)F)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H13F5N2OS/c1-16-6(2-3-18-5-8(11)12)7-4-17-9(19-7)10(13,14)15/h4,6,8,16H,2-3,5H2,1H3 |
| InChIKey | HVLGYAKNEMHIJR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|