C10H15F2NOS — CID 103149216
3-(2,2-difluoroethoxy)-N-methyl-1-thiophen-2-ylpropan-1-amine (PubChem CID 103149216) has the molecular formula C10H15F2NOS and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-methyl-1-thiophen-2-ylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-methyl-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 103149216 |
| Molecular Formula | C10H15F2NOS |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-methyl-1-thiophen-2-ylpropan-1-amine |
| SMILES | CNC(CCOCC(F)F)c1cccs1 |
| InChI | InChI=1S/C10H15F2NOS/c1-13-8(9-3-2-6-15-9)4-5-14-7-10(11)12/h2-3,6,8,10,13H,4-5,7H2,1H3 |
| InChIKey | ZCVKXLURQUZLST-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|