C11H17F2NOS — CID 103149318
3-(2,2-difluoroethoxy)-N-methyl-1-(5-methylthiophen-3-yl)propan-1-amine (PubChem CID 103149318) has the molecular formula C11H17F2NOS and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-methyl-1-(5-methylthiophen-3-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-methyl-1-(5-methylthiophen-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 103149318 |
| Molecular Formula | C11H17F2NOS |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-methyl-1-(5-methylthiophen-3-yl)propan-1-amine |
| SMILES | CNC(CCOCC(F)F)c1csc(C)c1 |
| InChI | InChI=1S/C11H17F2NOS/c1-8-5-9(7-16-8)10(14-2)3-4-15-6-11(12)13/h5,7,10-11,14H,3-4,6H2,1-2H3 |
| InChIKey | GCTYHITXPODLTH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|