C13H12ClFN2O3 — CID 114853257
(5-chloro-2-fluorophenyl)-(3,5-dimethoxypyrazin-2-yl)methanol (PubChem CID 114853257) has the molecular formula C13H12ClFN2O3 and a molecular weight of 298.70 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-(3,5-dimethoxypyrazin-2-yl)methanol.
| Compound Name | (5-chloro-2-fluorophenyl)-(3,5-dimethoxypyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 114853257 |
| Molecular Formula | C13H12ClFN2O3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-(3,5-dimethoxypyrazin-2-yl)methanol |
| SMILES | COc1cnc(C(O)c2cc(Cl)ccc2F)c(OC)n1 |
| InChI | InChI=1S/C13H12ClFN2O3/c1-19-10-6-16-11(13(17-10)20-2)12(18)8-5-7(14)3-4-9(8)15/h3-6,12,18H,1-2H3 |
| InChIKey | PTEKTDFCIJXESK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |