C12H20N2O4 — CID 116711920
1-(3,5-dimethoxypyrazin-2-yl)-2-methoxy-3-methylbutan-1-ol (PubChem CID 116711920) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-2-methoxy-3-methylbutan-1-ol.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-methoxy-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 116711920 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-methoxy-3-methylbutan-1-ol |
| SMILES | COc1cnc(C(O)C(OC)C(C)C)c(OC)n1 |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)11(17-4)10(15)9-12(18-5)14-8(16-3)6-13-9/h6-7,10-11,15H,1-5H3 |
| InChIKey | MWLKOOLTRSLAJN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |