C14H22N2O4 — CID 116753341
(3,5-dimethoxypyrazin-2-yl)-(1-methoxycyclohexyl)methanol (PubChem CID 116753341) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(1-methoxycyclohexyl)methanol.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(1-methoxycyclohexyl)methanol |
|---|---|
| PubChem CID | 116753341 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(1-methoxycyclohexyl)methanol |
| SMILES | COc1cnc(C(O)C2(OC)CCCCC2)c(OC)n1 |
| InChI | InChI=1S/C14H22N2O4/c1-18-10-9-15-11(13(16-10)19-2)12(17)14(20-3)7-5-4-6-8-14/h9,12,17H,4-8H2,1-3H3 |
| InChIKey | VVFFYLQAKQKHMV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |