C13H22N2O3 — CID 114270663
1-(3,5-dimethoxypyrazin-2-yl)-2,3,3-trimethylbutan-1-ol (PubChem CID 114270663) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-2,3,3-trimethylbutan-1-ol.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-2,3,3-trimethylbutan-1-ol |
|---|---|
| PubChem CID | 114270663 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-2,3,3-trimethylbutan-1-ol |
| SMILES | COc1cnc(C(O)C(C)C(C)(C)C)c(OC)n1 |
| InChI | InChI=1S/C13H22N2O3/c1-8(13(2,3)4)11(16)10-12(18-6)15-9(17-5)7-14-10/h7-8,11,16H,1-6H3 |
| InChIKey | DSCCQQLTPSIRSG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |