C13H22N2O4 — CID 103459914
1-(3,5-dimethoxypyrazin-2-yl)-3-ethylpentane-1,2-diol (PubChem CID 103459914) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-3-ethylpentane-1,2-diol.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-3-ethylpentane-1,2-diol |
|---|---|
| PubChem CID | 103459914 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-3-ethylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C13H22N2O4/c1-5-8(6-2)11(16)12(17)10-13(19-4)15-9(18-3)7-14-10/h7-8,11-12,16-17H,5-6H2,1-4H3 |
| InChIKey | HJRVZPGYGUVUPS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |