C12H16N4O3S — CID 105123476
(3,5-dimethoxypyrazin-2-yl)-(4-propylthiadiazol-5-yl)methanol (PubChem CID 105123476) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(4-propylthiadiazol-5-yl)methanol.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(4-propylthiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105123476 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(4-propylthiadiazol-5-yl)methanol |
| SMILES | CCCc1nnsc1C(O)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C12H16N4O3S/c1-4-5-7-11(20-16-15-7)10(17)9-12(19-3)14-8(18-2)6-13-9/h6,10,17H,4-5H2,1-3H3 |
| InChIKey | ITLAXGULOVTSNP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |