C10H12N2O2S — CID 105097375
furan-2-yl-(4-propylthiadiazol-5-yl)methanol (PubChem CID 105097375) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is furan-2-yl-(4-propylthiadiazol-5-yl)methanol.
| Compound Name | furan-2-yl-(4-propylthiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105097375 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | furan-2-yl-(4-propylthiadiazol-5-yl)methanol |
| SMILES | CCCc1nnsc1C(O)c1ccco1 |
| InChI | InChI=1S/C10H12N2O2S/c1-2-4-7-10(15-12-11-7)9(13)8-5-3-6-14-8/h3,5-6,9,13H,2,4H2,1H3 |
| InChIKey | YQAMLFHQXHNTQE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |